About 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate
2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate (PubChem CID 66827346) has the molecular formula C19H33NO2
and a molecular weight of 307.48 g/mol. Its IUPAC name is 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate |
| PubChem CID | 66827346 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate |
| SMILES | CC1CC2CC(C1)CC(C)(C(C)(C)OC(=O)N1CCCC1)C2 |
| InChI | InChI=1S/C19H33NO2/c1-14-9-15-11-16(10-14)13-19(4,12-15)18(2,3)22-17(21)20-7-5-6-8-20/h14-16H,5-13H2,1-4H3 |
| InChIKey | SVRFABFNSLJVPX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate?
The IUPAC name of 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate (CID 66827346) is 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate.
What is the SMILES notation for 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate?
The canonical SMILES for 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate is CC1CC2CC(C1)CC(C)(C(C)(C)OC(=O)N1CCCC1)C2.
What is the InChIKey of 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate?
The InChIKey is SVRFABFNSLJVPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33NO2/c1-14-9-15-11-16(10-14)13-19(4,12-15)18(2,3)22-17(21)20-7-5-6-8-20/h14-16H,5-13H2,1-4H3.
What are the key properties of 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate?
2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate has a molecular weight of 307.48 g/mol, XLogP of 4.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)propan-2-yl pyrrolidine-1-carboxylate is sourced from PubChem (CID 66827346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).