C15H26F2N4O — CID 66827424
2-(8-amino-8,8-difluorooctyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 66827424) has the molecular formula C15H26F2N4O and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-(8-amino-8,8-difluorooctyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 2-(8-amino-8,8-difluorooctyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 66827424 |
| Molecular Formula | C15H26F2N4O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 2-(8-amino-8,8-difluorooctyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | NC(F)(F)CCCCCCCC1=NC2(CCNCC2)C(=O)N1 |
| InChI | InChI=1S/C15H26F2N4O/c16-15(17,18)7-5-3-1-2-4-6-12-20-13(22)14(21-12)8-10-19-11-9-14/h19H,1-11,18H2,(H,20,21,22) |
| InChIKey | XVZTYIOUMOZTCV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|