C18H18N2O — CID 66827792
4-(4-aminophenyl)-1,3,4,6,7,8-hexahydrocyclopenta[g]quinolin-2-one (PubChem CID 66827792) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-(4-aminophenyl)-1,3,4,6,7,8-hexahydrocyclopenta[g]quinolin-2-one.
| Compound Name | 4-(4-aminophenyl)-1,3,4,6,7,8-hexahydrocyclopenta[g]quinolin-2-one |
|---|---|
| PubChem CID | 66827792 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4-(4-aminophenyl)-1,3,4,6,7,8-hexahydrocyclopenta[g]quinolin-2-one |
| SMILES | Nc1ccc(C2CC(=O)Nc3cc4c(cc32)CCC4)cc1 |
| InChI | InChI=1S/C18H18N2O/c19-14-6-4-11(5-7-14)15-10-18(21)20-17-9-13-3-1-2-12(13)8-16(15)17/h4-9,15H,1-3,10,19H2,(H,20,21) |
| InChIKey | LZEFZYXVBSQOOQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|