C11H14BN2O2 — CID 66827885
CID 66827885 (PubChem CID 66827885) has the molecular formula C11H14BN2O2 and a molecular weight of 217.06 g/mol.
| Compound Name | CID 66827885 |
|---|---|
| PubChem CID | 66827885 |
| Molecular Formula | C11H14BN2O2 |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | — |
| SMILES | CO[B]N1CCc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C11H14BN2O2/c1-8(15)13-10-3-4-11-9(7-10)5-6-14(11)12-16-2/h3-4,7H,5-6H2,1-2H3,(H,13,15) |
| InChIKey | UBWIOKDUCGOUJL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|