C36H35F3N2O4 — CID 66828037
13-cyclohexyl-3-methoxy-6-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid (PubChem CID 66828037) has the molecular formula C36H35F3N2O4 and a molecular weight of 616.68 g/mol. Its IUPAC name is 13-cyclohexyl-3-methoxy-6-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid.
| Compound Name | 13-cyclohexyl-3-methoxy-6-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid |
|---|---|
| PubChem CID | 66828037 |
| Molecular Formula | C36H35F3N2O4 |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | 13-cyclohexyl-3-methoxy-6-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid |
| SMILES | COc1ccc2c(c1)C=C(c1cc(C(F)(F)F)ccc1N1CCOCC1)Cn1c-2c(C2CCCCC2)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C36H35F3N2O4/c1-44-27-9-11-28-24(18-27)17-25(30-20-26(36(37,38)39)8-12-31(30)40-13-15-45-16-14-40)21-41-32-19-23(35(42)43)7-10-29(32)33(34(28)41)22-5-3-2-4-6-22/h7-12,17-20,22H,2-6,13-16,21H2,1H3,(H,42,43) |
| InChIKey | LHCWAVNLHUVKAW-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|