C12H17FN5O5P — CID 66828126
7-[(1R)-1-[[(4R,5R)-4-(1-fluoroethyl)-2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl]oxy]ethyl]imidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 66828126) has the molecular formula C12H17FN5O5P and a molecular weight of 361.27 g/mol. Its IUPAC name is 7-[(1R)-1-[[(4R,5R)-4-(1-fluoroethyl)-2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl]oxy]ethyl]imidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(1R)-1-[[(4R,5R)-4-(1-fluoroethyl)-2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl]oxy]ethyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 66828126 |
| Molecular Formula | C12H17FN5O5P |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 7-[(1R)-1-[[(4R,5R)-4-(1-fluoroethyl)-2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl]oxy]ethyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CC(F)[C@@H]1OP(=O)(O)OC[C@H]1O[C@H](C)c1cnc2c(N)ncnn12 |
| InChI | InChI=1S/C12H17FN5O5P/c1-6(13)10-9(4-21-24(19,20)23-10)22-7(2)8-3-15-12-11(14)16-5-17-18(8)12/h3,5-7,9-10H,4H2,1-2H3,(H,19,20)(H2,14,16,17)/t6?,7-,9-,10+/m1/s1 |
| InChIKey | LYYXKBLJPCDJCT-XNWUYTQLSA-N |
| XLogP | 1.03 |
| TPSA | 134.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|