C32H34N7O7P — CID 66828203
ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 66828203) has the molecular formula C32H34N7O7P and a molecular weight of 659.64 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 66828203 |
| Molecular Formula | C32H34N7O7P |
| Molecular Weight | 659.64 g/mol |
| Exact Mass | 659.23 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1c[nH]c2ccccc12)NP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@@H](C)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C32H34N7O7P/c1-3-43-31(41)25(15-21-16-35-24-12-8-7-11-23(21)24)38-47(42,46-22-9-5-4-6-10-22)44-17-27-29(40)20(2)32(18-33,45-27)28-14-13-26-30(34)36-19-37-39(26)28/h4-14,16,19-20,25,27,29,35,40H,3,15,17H2,1-2H3,(H,38,42)(H2,34,36,37)/t20-,25-,27+,29-,32+,47?/m0/s1 |
| InChIKey | ZUXZUELAQSDZCA-ZMBYKSGRSA-N |
| XLogP | 3.88 |
| TPSA | 199.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.64 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|