C13H17N — CID 66828383
(4aS)-3-methyl-2,4a,4b,8a,9,9a-hexahydro-1H-carbazole (PubChem CID 66828383) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (4aS)-3-methyl-2,4a,4b,8a,9,9a-hexahydro-1H-carbazole.
| Compound Name | (4aS)-3-methyl-2,4a,4b,8a,9,9a-hexahydro-1H-carbazole |
|---|---|
| PubChem CID | 66828383 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (4aS)-3-methyl-2,4a,4b,8a,9,9a-hexahydro-1H-carbazole |
| SMILES | CC1=C[C@@H]2C(CC1)NC1C=CC=CC12 |
| InChI | InChI=1S/C13H17N/c1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13/h2-5,8,10-14H,6-7H2,1H3/t10?,11-,12?,13?/m0/s1 |
| InChIKey | JPLSKWMLECVGFB-ZNOXQBFJSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|