C20H18F2N4O3 — CID 66828672
(10R,10aR)-2'-amino-7-fluoro-8-(2-fluoro-3-pyridinyl)-3'-methylspiro[3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromene-10,5'-imidazole]-4'-one (PubChem CID 66828672) has the molecular formula C20H18F2N4O3 and a molecular weight of 400.39 g/mol. Its IUPAC name is (10R,10aR)-2'-amino-7-fluoro-8-(2-fluoro-3-pyridinyl)-3'-methylspiro[3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromene-10,5'-imidazole]-4'-one.
| Compound Name | (10R,10aR)-2'-amino-7-fluoro-8-(2-fluoro-3-pyridinyl)-3'-methylspiro[3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromene-10,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 66828672 |
| Molecular Formula | C20H18F2N4O3 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (10R,10aR)-2'-amino-7-fluoro-8-(2-fluoro-3-pyridinyl)-3'-methylspiro[3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromene-10,5'-imidazole]-4'-one |
| SMILES | CN1C(=O)[C@@]2(N=C1N)c1cc(-c3cccnc3F)c(F)cc1OC1CCCO[C@@H]12 |
| InChI | InChI=1S/C20H18F2N4O3/c1-26-18(27)20(25-19(26)23)12-8-11(10-4-2-6-24-17(10)22)13(21)9-15(12)29-14-5-3-7-28-16(14)20/h2,4,6,8-9,14,16H,3,5,7H2,1H3,(H2,23,25)/t14?,16-,20+/m0/s1 |
| InChIKey | ZCIVIIMMWRUCPR-PNKJRWENSA-N |
| XLogP | 1.95 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|