C22H34O8 — CID 66828706
[(3S,6R)-3,4-diacetyloxy-6-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxan-2-yl]methyl acetate (PubChem CID 66828706) has the molecular formula C22H34O8 and a molecular weight of 426.51 g/mol. Its IUPAC name is [(3S,6R)-3,4-diacetyloxy-6-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3S,6R)-3,4-diacetyloxy-6-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 66828706 |
| Molecular Formula | C22H34O8 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | [(3S,6R)-3,4-diacetyloxy-6-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OC/C=C(\C)CCC=C(C)C)CC(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H34O8/c1-14(2)8-7-9-15(3)10-11-26-21-12-19(28-17(5)24)22(29-18(6)25)20(30-21)13-27-16(4)23/h8,10,19-22H,7,9,11-13H2,1-6H3/b15-10+/t19?,20?,21-,22+/m1/s1 |
| InChIKey | ZLIZUOLIYUCEKF-HHLCATLASA-N |
| XLogP | 3.24 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|