C20H35N3O4 — CID 66828758
tert-butyl N-[(2S)-1-[(2S,4R)-2-carbamoyl-3,4-dimethylpyrrolidin-1-yl]-1-oxooct-7-en-2-yl]carbamate (PubChem CID 66828758) has the molecular formula C20H35N3O4 and a molecular weight of 381.52 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(2S,4R)-2-carbamoyl-3,4-dimethylpyrrolidin-1-yl]-1-oxooct-7-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(2S,4R)-2-carbamoyl-3,4-dimethylpyrrolidin-1-yl]-1-oxooct-7-en-2-yl]carbamate |
|---|---|
| PubChem CID | 66828758 |
| Molecular Formula | C20H35N3O4 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(2S,4R)-2-carbamoyl-3,4-dimethylpyrrolidin-1-yl]-1-oxooct-7-en-2-yl]carbamate |
| SMILES | C=CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@H](C)C(C)[C@H]1C(N)=O |
| InChI | InChI=1S/C20H35N3O4/c1-7-8-9-10-11-15(22-19(26)27-20(4,5)6)18(25)23-12-13(2)14(3)16(23)17(21)24/h7,13-16H,1,8-12H2,2-6H3,(H2,21,24)(H,22,26)/t13-,14?,15-,16-/m0/s1 |
| InChIKey | JJIFSSLKYOISPR-PBBYBOOSSA-N |
| XLogP | 2.59 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|