About (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide
(2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide (PubChem CID 66828881) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide |
| PubChem CID | 66828881 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(N)=O)N(C(=O)CC(C)(C)C)C1 |
| InChI | InChI=1S/C12H22N2O2/c1-8-5-9(11(13)16)14(7-8)10(15)6-12(2,3)4/h8-9H,5-7H2,1-4H3,(H2,13,16)/t8-,9-/m0/s1 |
| InChIKey | GSNHOQQMNGVRTJ-IUCAKERBSA-N |
| XLogP | 1.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide?
The IUPAC name of (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide (CID 66828881) is (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide.
What is the SMILES notation for (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide?
The canonical SMILES for (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide is C[C@H]1C[C@@H](C(N)=O)N(C(=O)CC(C)(C)C)C1.
What is the InChIKey of (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide?
The InChIKey is GSNHOQQMNGVRTJ-IUCAKERBSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-8-5-9(11(13)16)14(7-8)10(15)6-12(2,3)4/h8-9H,5-7H2,1-4H3,(H2,13,16)/t8-,9-/m0/s1.
What are the key properties of (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide?
(2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide has a molecular weight of 226.32 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-1-(3,3-dimethylbutanoyl)-4-methylpyrrolidine-2-carboxamide is sourced from PubChem (CID 66828881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).