C13H16N4O3 — CID 66828915
methyl 4-(oxan-4-ylamino)-1H-pyrazolo[4,3-c]pyridine-3-carboxylate (PubChem CID 66828915) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is methyl 4-(oxan-4-ylamino)-1H-pyrazolo[4,3-c]pyridine-3-carboxylate.
| Compound Name | methyl 4-(oxan-4-ylamino)-1H-pyrazolo[4,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 66828915 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | methyl 4-(oxan-4-ylamino)-1H-pyrazolo[4,3-c]pyridine-3-carboxylate |
| SMILES | COC(=O)c1n[nH]c2ccnc(NC3CCOCC3)c12 |
| InChI | InChI=1S/C13H16N4O3/c1-19-13(18)11-10-9(16-17-11)2-5-14-12(10)15-8-3-6-20-7-4-8/h2,5,8H,3-4,6-7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | NOOPYGWGFGEZOE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |