About 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine
5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine (PubChem CID 66829363) has the molecular formula C23H19FN4
and a molecular weight of 370.43 g/mol. Its IUPAC name is 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine |
| PubChem CID | 66829363 |
| Molecular Formula | C23H19FN4 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine |
| SMILES | Nc1ccc(-c2cc(F)ccc2CC(c2cccnc2)c2cccnc2)cn1 |
| InChI | InChI=1S/C23H19FN4/c24-20-7-5-16(22(12-20)19-6-8-23(25)28-15-19)11-21(17-3-1-9-26-13-17)18-4-2-10-27-14-18/h1-10,12-15,21H,11H2,(H2,25,28) |
| InChIKey | HIZLMRAMNLHBGW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine?
The IUPAC name of 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine (CID 66829363) is 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine.
What is the SMILES notation for 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine?
The canonical SMILES for 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine is Nc1ccc(-c2cc(F)ccc2CC(c2cccnc2)c2cccnc2)cn1.
What is the InChIKey of 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine?
The InChIKey is HIZLMRAMNLHBGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19FN4/c24-20-7-5-16(22(12-20)19-6-8-23(25)28-15-19)11-21(17-3-1-9-26-13-17)18-4-2-10-27-14-18/h1-10,12-15,21H,11H2,(H2,25,28).
What are the key properties of 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine?
5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine has a molecular weight of 370.43 g/mol, XLogP of 4.63, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]pyridin-2-amine is sourced from PubChem (CID 66829363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).