About N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide
N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide (PubChem CID 66829372) has the molecular formula C25H22FN3O2S
and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide |
| PubChem CID | 66829372 |
| Molecular Formula | C25H22FN3O2S |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2cc(F)ccc2CC(c2cccnc2)c2cccnc2)c1 |
| InChI | InChI=1S/C25H22FN3O2S/c1-32(30,31)29-23-8-2-5-18(13-23)25-15-22(26)10-9-19(25)14-24(20-6-3-11-27-16-20)21-7-4-12-28-17-21/h2-13,15-17,24,29H,14H2,1H3 |
| InChIKey | VABFAANGVSTHRS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide?
The IUPAC name of N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide (CID 66829372) is N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide?
The canonical SMILES for N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide is CS(=O)(=O)Nc1cccc(-c2cc(F)ccc2CC(c2cccnc2)c2cccnc2)c1.
What is the InChIKey of N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide?
The InChIKey is VABFAANGVSTHRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22FN3O2S/c1-32(30,31)29-23-8-2-5-18(13-23)25-15-22(26)10-9-19(25)14-24(20-6-3-11-27-16-20)21-7-4-12-28-17-21/h2-13,15-17,24,29H,14H2,1H3.
What are the key properties of N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide?
N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide has a molecular weight of 447.54 g/mol, XLogP of 5.03, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]phenyl]methanesulfonamide is sourced from PubChem (CID 66829372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).