About 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine
1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine (PubChem CID 66829500) has the molecular formula C28H28FN5
and a molecular weight of 453.57 g/mol. Its IUPAC name is 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine |
| PubChem CID | 66829500 |
| Molecular Formula | C28H28FN5 |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine |
| SMILES | CN1CCN(c2ccc(-c3cc(F)ccc3CC(c3cccnc3)c3cccnc3)cn2)CC1 |
| InChI | InChI=1S/C28H28FN5/c1-33-12-14-34(15-13-33)28-9-7-24(20-32-28)27-17-25(29)8-6-21(27)16-26(22-4-2-10-30-18-22)23-5-3-11-31-19-23/h2-11,17-20,26H,12-16H2,1H3 |
| InChIKey | RGHGLBVTBSKOIN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine?
The IUPAC name of 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine (CID 66829500) is 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine.
What is the SMILES notation for 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine?
The canonical SMILES for 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine is CN1CCN(c2ccc(-c3cc(F)ccc3CC(c3cccnc3)c3cccnc3)cn2)CC1.
What is the InChIKey of 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine?
The InChIKey is RGHGLBVTBSKOIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28FN5/c1-33-12-14-34(15-13-33)28-9-7-24(20-32-28)27-17-25(29)8-6-21(27)16-26(22-4-2-10-30-18-22)23-5-3-11-31-19-23/h2-11,17-20,26H,12-16H2,1H3.
What are the key properties of 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine?
1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine has a molecular weight of 453.57 g/mol, XLogP of 4.80, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[2-(2,2-dipyridin-3-ylethyl)-5-fluorophenyl]-2-pyridinyl]-4-methylpiperazine is sourced from PubChem (CID 66829500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).