About 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide
2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide (PubChem CID 66829799) has the molecular formula C19H23N3O5
and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide |
| PubChem CID | 66829799 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide |
| SMILES | CCCNC(=O)COc1c(C(=O)Cc2cnccn2)ccc(OC)c1OC |
| InChI | InChI=1S/C19H23N3O5/c1-4-7-22-17(24)12-27-18-14(5-6-16(25-2)19(18)26-3)15(23)10-13-11-20-8-9-21-13/h5-6,8-9,11H,4,7,10,12H2,1-3H3,(H,22,24) |
| InChIKey | GTELPGRUGWWEFG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide?
The IUPAC name of 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide (CID 66829799) is 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide.
What is the SMILES notation for 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide?
The canonical SMILES for 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide is CCCNC(=O)COc1c(C(=O)Cc2cnccn2)ccc(OC)c1OC.
What is the InChIKey of 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide?
The InChIKey is GTELPGRUGWWEFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O5/c1-4-7-22-17(24)12-27-18-14(5-6-16(25-2)19(18)26-3)15(23)10-13-11-20-8-9-21-13/h5-6,8-9,11H,4,7,10,12H2,1-3H3,(H,22,24).
What are the key properties of 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide?
2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide has a molecular weight of 373.41 g/mol, XLogP of 1.82, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dimethoxy-6-(2-pyrazin-2-ylacetyl)phenoxy]-N-propylacetamide is sourced from PubChem (CID 66829799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).