C20H22Cl2N2O6 — CID 66829804
2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]-N-(2-methoxyethyl)acetamide (PubChem CID 66829804) has the molecular formula C20H22Cl2N2O6 and a molecular weight of 457.31 g/mol. Its IUPAC name is 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 66829804 |
| Molecular Formula | C20H22Cl2N2O6 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)COc1c(C(=O)Cc2c(Cl)cncc2Cl)ccc(OC)c1OC |
| InChI | InChI=1S/C20H22Cl2N2O6/c1-27-7-6-24-18(26)11-30-19-12(4-5-17(28-2)20(19)29-3)16(25)8-13-14(21)9-23-10-15(13)22/h4-5,9-10H,6-8,11H2,1-3H3,(H,24,26) |
| InChIKey | MNVHICQKUBKNGT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|