About 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide
5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide (PubChem CID 66829854) has the molecular formula C14H27N5O
and a molecular weight of 281.40 g/mol. Its IUPAC name is 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide |
| PubChem CID | 66829854 |
| Molecular Formula | C14H27N5O |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)CCCC(C)NC(=O)c1nnc(N(C)C)n1C |
| InChI | InChI=1S/C14H27N5O/c1-10(2)8-7-9-11(3)15-13(20)12-16-17-14(18(4)5)19(12)6/h10-11H,7-9H2,1-6H3,(H,15,20) |
| InChIKey | FIBTZNNVGCWBJZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide?
The IUPAC name of 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide (CID 66829854) is 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide is CC(C)CCCC(C)NC(=O)c1nnc(N(C)C)n1C.
What is the InChIKey of 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide?
The InChIKey is FIBTZNNVGCWBJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N5O/c1-10(2)8-7-9-11(3)15-13(20)12-16-17-14(18(4)5)19(12)6/h10-11H,7-9H2,1-6H3,(H,15,20).
What are the key properties of 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide?
5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide has a molecular weight of 281.40 g/mol, XLogP of 1.83, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-4-methyl-N-(6-methylheptan-2-yl)-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 66829854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).