C20H16N4O2 — CID 66829924
3-[3-(2,2-dipyridin-3-ylethyl)phenyl]oxadiazol-3-ium-5-olate (PubChem CID 66829924) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is 3-[3-(2,2-dipyridin-3-ylethyl)phenyl]oxadiazol-3-ium-5-olate.
| Compound Name | 3-[3-(2,2-dipyridin-3-ylethyl)phenyl]oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 66829924 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 3-[3-(2,2-dipyridin-3-ylethyl)phenyl]oxadiazol-3-ium-5-olate |
| SMILES | [O-]c1c[n+](-c2cccc(CC(c3cccnc3)c3cccnc3)c2)no1 |
| InChI | InChI=1S/C20H16N4O2/c25-20-14-24(23-26-20)18-7-1-4-15(10-18)11-19(16-5-2-8-21-12-16)17-6-3-9-22-13-17/h1-10,12-14,19H,11H2 |
| InChIKey | RYUOERWWQNNDIS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|