About 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine
6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine (PubChem CID 66829976) has the molecular formula C22H19FN6
and a molecular weight of 386.43 g/mol. Its IUPAC name is 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine.
Molecular Properties
| Compound Name | 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine |
| PubChem CID | 66829976 |
| Molecular Formula | C22H19FN6 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine |
| SMILES | Nc1cccc(Nc2ncccc2CC(c2cccnc2)c2cccnc2F)n1 |
| InChI | InChI=1S/C22H19FN6/c23-21-17(7-4-11-26-21)18(16-6-2-10-25-14-16)13-15-5-3-12-27-22(15)29-20-9-1-8-19(24)28-20/h1-12,14,18H,13H2,(H3,24,27,28,29) |
| InChIKey | DWVZLDYIUWSUJB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine?
The IUPAC name of 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine (CID 66829976) is 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine.
What is the SMILES notation for 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine?
The canonical SMILES for 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine is Nc1cccc(Nc2ncccc2CC(c2cccnc2)c2cccnc2F)n1.
What is the InChIKey of 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine?
The InChIKey is DWVZLDYIUWSUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FN6/c23-21-17(7-4-11-26-21)18(16-6-2-10-25-14-16)13-15-5-3-12-27-22(15)29-20-9-1-8-19(24)28-20/h1-12,14,18H,13H2,(H3,24,27,28,29).
What are the key properties of 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine?
6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine has a molecular weight of 386.43 g/mol, XLogP of 4.11, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-[3-[2-(2-fluoro-3-pyridinyl)-2-pyridin-3-ylethyl]-2-pyridinyl]pyridine-2,6-diamine is sourced from PubChem (CID 66829976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).