About 2-carboxyphenolate;1H-imidazol-3-ium
2-carboxyphenolate;1H-imidazol-3-ium (PubChem CID 66830803) has the molecular formula C10H10N2O3
and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-carboxyphenolate;1H-imidazol-3-ium.
Molecular Properties
| Compound Name | 2-carboxyphenolate;1H-imidazol-3-ium |
| PubChem CID | 66830803 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-carboxyphenolate;1H-imidazol-3-ium |
| SMILES | O=C(O)c1ccccc1[O-].c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C7H6O3.C3H4N2/c8-6-4-2-1-3-5(6)7(9)10;1-2-5-3-4-1/h1-4,8H,(H,9,10);1-3H,(H,4,5) |
| InChIKey | XCHHJFVNQPPLJK-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-carboxyphenolate;1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyphenolate;1H-imidazol-3-ium?
The IUPAC name of 2-carboxyphenolate;1H-imidazol-3-ium (CID 66830803) is 2-carboxyphenolate;1H-imidazol-3-ium.
What is the SMILES notation for 2-carboxyphenolate;1H-imidazol-3-ium?
The canonical SMILES for 2-carboxyphenolate;1H-imidazol-3-ium is O=C(O)c1ccccc1[O-].c1c[nH+]c[nH]1.
What is the InChIKey of 2-carboxyphenolate;1H-imidazol-3-ium?
The InChIKey is XCHHJFVNQPPLJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C3H4N2/c8-6-4-2-1-3-5(6)7(9)10;1-2-5-3-4-1/h1-4,8H,(H,9,10);1-3H,(H,4,5).
What are the key properties of 2-carboxyphenolate;1H-imidazol-3-ium?
2-carboxyphenolate;1H-imidazol-3-ium has a molecular weight of 206.20 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyphenolate;1H-imidazol-3-ium is sourced from PubChem (CID 66830803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).