C29H43N3O7Si — CID 66831160
tert-butyl N-[3-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]-2-oxo-3H-pyridin-6-yl]-N-[(2-nitrophenyl)methyl]carbamate (PubChem CID 66831160) has the molecular formula C29H43N3O7Si and a molecular weight of 573.76 g/mol. Its IUPAC name is tert-butyl N-[3-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]-2-oxo-3H-pyridin-6-yl]-N-[(2-nitrophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]-2-oxo-3H-pyridin-6-yl]-N-[(2-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 66831160 |
| Molecular Formula | C29H43N3O7Si |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | tert-butyl N-[3-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]-2-oxo-3H-pyridin-6-yl]-N-[(2-nitrophenyl)methyl]carbamate |
| SMILES | CC[C@H]1O[C@@H](C2C=CC(N(Cc3ccccc3[N+](=O)[O-])C(=O)OC(C)(C)C)=NC2=O)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H43N3O7Si/c1-10-22-24(39-40(8,9)29(5,6)7)17-23(37-22)20-15-16-25(30-26(20)33)31(27(34)38-28(2,3)4)18-19-13-11-12-14-21(19)32(35)36/h11-16,20,22-24H,10,17-18H2,1-9H3/t20?,22-,23-,24?/m1/s1 |
| InChIKey | OJJVSDAENYMZPK-LQBIAYRMSA-N |
| XLogP | 6.40 |
| TPSA | 120.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|