About (4S)-4-acetyl-1,3-oxazolidin-2-one
(4S)-4-acetyl-1,3-oxazolidin-2-one (PubChem CID 66831189) has the molecular formula C5H7NO3
and a molecular weight of 129.11 g/mol. Its IUPAC name is (4S)-4-acetyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4S)-4-acetyl-1,3-oxazolidin-2-one |
| PubChem CID | 66831189 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | (4S)-4-acetyl-1,3-oxazolidin-2-one |
| SMILES | CC(=O)[C@@H]1COC(=O)N1 |
| InChI | InChI=1S/C5H7NO3/c1-3(7)4-2-9-5(8)6-4/h4H,2H2,1H3,(H,6,8)/t4-/m0/s1 |
| InChIKey | FCVBTNQDBPMCCJ-BYPYZUCNSA-N |
| XLogP | -0.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-acetyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-acetyl-1,3-oxazolidin-2-one?
The IUPAC name of (4S)-4-acetyl-1,3-oxazolidin-2-one (CID 66831189) is (4S)-4-acetyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4S)-4-acetyl-1,3-oxazolidin-2-one?
The canonical SMILES for (4S)-4-acetyl-1,3-oxazolidin-2-one is CC(=O)[C@@H]1COC(=O)N1.
What is the InChIKey of (4S)-4-acetyl-1,3-oxazolidin-2-one?
The InChIKey is FCVBTNQDBPMCCJ-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H7NO3/c1-3(7)4-2-9-5(8)6-4/h4H,2H2,1H3,(H,6,8)/t4-/m0/s1.
What are the key properties of (4S)-4-acetyl-1,3-oxazolidin-2-one?
(4S)-4-acetyl-1,3-oxazolidin-2-one has a molecular weight of 129.11 g/mol, XLogP of -0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-acetyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 66831189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).