C18H28N4O9 — CID 66831528
[(2R,3R,4R,5R)-5-[4-(ethoxycarbonylamino)-2-oxopyrimidin-1-yl]-4,5-dihydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] (2S)-2-amino-3-methylbutanoate (PubChem CID 66831528) has the molecular formula C18H28N4O9 and a molecular weight of 444.44 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[4-(ethoxycarbonylamino)-2-oxopyrimidin-1-yl]-4,5-dihydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3R,4R,5R)-5-[4-(ethoxycarbonylamino)-2-oxopyrimidin-1-yl]-4,5-dihydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 66831528 |
| Molecular Formula | C18H28N4O9 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[4-(ethoxycarbonylamino)-2-oxopyrimidin-1-yl]-4,5-dihydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] (2S)-2-amino-3-methylbutanoate |
| SMILES | CCOC(=O)Nc1ccn([C@]2(O)O[C@H](CO)[C@@H](OC(=O)[C@@H](N)C(C)C)[C@@]2(C)O)c(=O)n1 |
| InChI | InChI=1S/C18H28N4O9/c1-5-29-16(26)21-11-6-7-22(15(25)20-11)18(28)17(4,27)13(10(8-23)31-18)30-14(24)12(19)9(2)3/h6-7,9-10,12-13,23,27-28H,5,8,19H2,1-4H3,(H,20,21,25,26)/t10-,12+,13-,17-,18-/m1/s1 |
| InChIKey | LLNYXVOFLWSWBZ-CZGBLHMCSA-N |
| XLogP | -1.55 |
| TPSA | 195.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |