C19H33N3O8Si — CID 66831590
ethyl N-[1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,4-trihydroxy-3-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 66831590) has the molecular formula C19H33N3O8Si and a molecular weight of 459.57 g/mol. Its IUPAC name is ethyl N-[1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,4-trihydroxy-3-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | ethyl N-[1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,4-trihydroxy-3-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 66831590 |
| Molecular Formula | C19H33N3O8Si |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | ethyl N-[1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,4-trihydroxy-3-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccn([C@]2(O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@]2(C)O)c(=O)n1 |
| InChI | InChI=1S/C19H33N3O8Si/c1-8-28-16(25)21-13-9-10-22(15(24)20-13)19(27)18(5,26)14(23)12(30-19)11-29-31(6,7)17(2,3)4/h9-10,12,14,23,26-27H,8,11H2,1-7H3,(H,20,21,24,25)/t12-,14-,18-,19-/m1/s1 |
| InChIKey | FJAOKSUAQYNAOX-NCGUTPBLSA-N |
| XLogP | 0.95 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|