C17H23NO5 — CID 66831592
8-methoxy-4-morpholin-4-yl-2,3,4,4a,10,10a-hexahydropyrano[3,2-b]chromen-10-ol (PubChem CID 66831592) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 8-methoxy-4-morpholin-4-yl-2,3,4,4a,10,10a-hexahydropyrano[3,2-b]chromen-10-ol.
| Compound Name | 8-methoxy-4-morpholin-4-yl-2,3,4,4a,10,10a-hexahydropyrano[3,2-b]chromen-10-ol |
|---|---|
| PubChem CID | 66831592 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 8-methoxy-4-morpholin-4-yl-2,3,4,4a,10,10a-hexahydropyrano[3,2-b]chromen-10-ol |
| SMILES | COc1ccc2c(c1)C(O)C1OCCC(N3CCOCC3)C1O2 |
| InChI | InChI=1S/C17H23NO5/c1-20-11-2-3-14-12(10-11)15(19)17-16(23-14)13(4-7-22-17)18-5-8-21-9-6-18/h2-3,10,13,15-17,19H,4-9H2,1H3 |
| InChIKey | ZZBGLULNESMWJT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |