C15H14BrFN2O4 — CID 66831821
(4aS,10R,10aR)-8-bromo-7-fluoro-3'-methylspiro[3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromene-10,5'-imidazolidine]-2',4'-dione (PubChem CID 66831821) has the molecular formula C15H14BrFN2O4 and a molecular weight of 385.19 g/mol. Its IUPAC name is (4aS,10R,10aR)-8-bromo-7-fluoro-3'-methylspiro[3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromene-10,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4aS,10R,10aR)-8-bromo-7-fluoro-3'-methylspiro[3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromene-10,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 66831821 |
| Molecular Formula | C15H14BrFN2O4 |
| Molecular Weight | 385.19 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (4aS,10R,10aR)-8-bromo-7-fluoro-3'-methylspiro[3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromene-10,5'-imidazolidine]-2',4'-dione |
| SMILES | CN1C(=O)N[C@]2(C1=O)c1cc(Br)c(F)cc1O[C@H]1CCCO[C@@H]12 |
| InChI | InChI=1S/C15H14BrFN2O4/c1-19-13(20)15(18-14(19)21)7-5-8(16)9(17)6-11(7)23-10-3-2-4-22-12(10)15/h5-6,10,12H,2-4H2,1H3,(H,18,21)/t10-,12-,15+/m0/s1 |
| InChIKey | XRPKHKPHZWIGJF-ITDIGPHOSA-N |
| XLogP | 1.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|