C14H12BrFN2O4 — CID 66831823
(4aS,10S,10aR)-8-bromo-7-fluorospiro[3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromene-10,5'-imidazolidine]-2',4'-dione (PubChem CID 66831823) has the molecular formula C14H12BrFN2O4 and a molecular weight of 371.16 g/mol. Its IUPAC name is (4aS,10S,10aR)-8-bromo-7-fluorospiro[3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromene-10,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4aS,10S,10aR)-8-bromo-7-fluorospiro[3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromene-10,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 66831823 |
| Molecular Formula | C14H12BrFN2O4 |
| Molecular Weight | 371.16 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | (4aS,10S,10aR)-8-bromo-7-fluorospiro[3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromene-10,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)[C@]2(N1)c1cc(Br)c(F)cc1O[C@H]1CCCO[C@@H]12 |
| InChI | InChI=1S/C14H12BrFN2O4/c15-7-4-6-10(5-8(7)16)22-9-2-1-3-21-11(9)14(6)12(19)17-13(20)18-14/h4-5,9,11H,1-3H2,(H2,17,18,19,20)/t9-,11-,14-/m0/s1 |
| InChIKey | XCSXQOCKZNAJGI-CHIMOYNISA-N |
| XLogP | 1.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.16 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|