C16H19N3O3 — CID 66831905
(4aS,10aS)-2'-amino-8-hydroxy-3'-methylspiro[1,3,4,4a,5,10a-hexahydrobenzo[g]isochromene-10,5'-imidazole]-4'-one (PubChem CID 66831905) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (4aS,10aS)-2'-amino-8-hydroxy-3'-methylspiro[1,3,4,4a,5,10a-hexahydrobenzo[g]isochromene-10,5'-imidazole]-4'-one.
| Compound Name | (4aS,10aS)-2'-amino-8-hydroxy-3'-methylspiro[1,3,4,4a,5,10a-hexahydrobenzo[g]isochromene-10,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 66831905 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (4aS,10aS)-2'-amino-8-hydroxy-3'-methylspiro[1,3,4,4a,5,10a-hexahydrobenzo[g]isochromene-10,5'-imidazole]-4'-one |
| SMILES | CN1C(=O)C2(N=C1N)c1cc(O)ccc1C[C@H]1CCOC[C@@H]12 |
| InChI | InChI=1S/C16H19N3O3/c1-19-14(21)16(18-15(19)17)12-7-11(20)3-2-9(12)6-10-4-5-22-8-13(10)16/h2-3,7,10,13,20H,4-6,8H2,1H3,(H2,17,18)/t10-,13+,16?/m1/s1 |
| InChIKey | YZQHPPJQBKZJRF-QWWHPRRQSA-N |
| XLogP | 0.58 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |