C23H20ClF3N4O4 — CID 66831930
[2'-amino-7-(5-chloro-3-pyridinyl)-1'-methyl-5'-oxospiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-imidazole]-3-yl] 2,2,2-trifluoroacetate (PubChem CID 66831930) has the molecular formula C23H20ClF3N4O4 and a molecular weight of 508.88 g/mol. Its IUPAC name is [2'-amino-7-(5-chloro-3-pyridinyl)-1'-methyl-5'-oxospiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-imidazole]-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2'-amino-7-(5-chloro-3-pyridinyl)-1'-methyl-5'-oxospiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-imidazole]-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 66831930 |
| Molecular Formula | C23H20ClF3N4O4 |
| Molecular Weight | 508.88 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | [2'-amino-7-(5-chloro-3-pyridinyl)-1'-methyl-5'-oxospiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-imidazole]-3-yl] 2,2,2-trifluoroacetate |
| SMILES | CN1C(=O)C2(N=C1N)c1cc(-c3cncc(Cl)c3)ccc1OC1CC(OC(=O)C(F)(F)F)CCC12 |
| InChI | InChI=1S/C23H20ClF3N4O4/c1-31-19(32)22(30-21(31)28)15-4-3-14(34-20(33)23(25,26)27)8-18(15)35-17-5-2-11(7-16(17)22)12-6-13(24)10-29-9-12/h2,5-7,9-10,14-15,18H,3-4,8H2,1H3,(H2,28,30) |
| InChIKey | AGHIBVUKDBELTE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.88 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |