About 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide
4-(ethoxymethyl)-1,2-oxazole-3-carboxamide (PubChem CID 66832011) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 66832011 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCOCc1conc1C(N)=O |
| InChI | InChI=1S/C7H10N2O3/c1-2-11-3-5-4-12-9-6(5)7(8)10/h4H,2-3H2,1H3,(H2,8,10) |
| InChIKey | BUEFBFATAPMGHO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide (CID 66832011) is 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide is CCOCc1conc1C(N)=O.
What is the InChIKey of 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide?
The InChIKey is BUEFBFATAPMGHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-2-11-3-5-4-12-9-6(5)7(8)10/h4H,2-3H2,1H3,(H2,8,10).
What are the key properties of 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide?
4-(ethoxymethyl)-1,2-oxazole-3-carboxamide has a molecular weight of 170.17 g/mol, XLogP of 0.31, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethoxymethyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 66832011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).