C31H40N4O6S — CID 66832524
methyl N-[(2S)-1-[[(2S,3S,5S)-3-hydroxy-1,6-diphenyl-5-(1,3-thiazol-5-ylmethoxycarbonylamino)hexan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 66832524) has the molecular formula C31H40N4O6S and a molecular weight of 596.75 g/mol. Its IUPAC name is methyl N-[(2S)-1-[[(2S,3S,5S)-3-hydroxy-1,6-diphenyl-5-(1,3-thiazol-5-ylmethoxycarbonylamino)hexan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[[(2S,3S,5S)-3-hydroxy-1,6-diphenyl-5-(1,3-thiazol-5-ylmethoxycarbonylamino)hexan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 66832524 |
| Molecular Formula | C31H40N4O6S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | methyl N-[(2S)-1-[[(2S,3S,5S)-3-hydroxy-1,6-diphenyl-5-(1,3-thiazol-5-ylmethoxycarbonylamino)hexan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)OCc1cncs1)C(C)(C)C |
| InChI | InChI=1S/C31H40N4O6S/c1-31(2,3)27(35-29(38)40-4)28(37)34-25(16-22-13-9-6-10-14-22)26(36)17-23(15-21-11-7-5-8-12-21)33-30(39)41-19-24-18-32-20-42-24/h5-14,18,20,23,25-27,36H,15-17,19H2,1-4H3,(H,33,39)(H,34,37)(H,35,38)/t23-,25-,26-,27+/m0/s1 |
| InChIKey | XSXAMCHYSJFUQA-PGXSJUQOSA-N |
| XLogP | 4.23 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |