About (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride
(2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride (PubChem CID 66832804) has the molecular formula C13H29BCl2N2O5
and a molecular weight of 375.10 g/mol. Its IUPAC name is (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride |
| PubChem CID | 66832804 |
| Molecular Formula | C13H29BCl2N2O5 |
| Molecular Weight | 375.10 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride |
| SMILES | Cl.Cl.N[C@](CCCCB(O)O)(CCN1CCC[C@H](O)C1)C(=O)O |
| InChI | InChI=1S/C13H27BN2O5.2ClH/c15-13(12(18)19,5-1-2-7-14(20)21)6-9-16-8-3-4-11(17)10-16;;/h11,17,20-21H,1-10,15H2,(H,18,19);2*1H/t11-,13+;;/m0../s1 |
| InChIKey | BMRSBRFCAZRQFS-VZCPBZATSA-N |
| XLogP | 0.10 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.10 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride?
The IUPAC name of (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride (CID 66832804) is (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride.
What is the SMILES notation for (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride?
The canonical SMILES for (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride is Cl.Cl.N[C@](CCCCB(O)O)(CCN1CCC[C@H](O)C1)C(=O)O.
What is the InChIKey of (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride?
The InChIKey is BMRSBRFCAZRQFS-VZCPBZATSA-N. The full InChI is InChI=1S/C13H27BN2O5.2ClH/c15-13(12(18)19,5-1-2-7-14(20)21)6-9-16-8-3-4-11(17)10-16;;/h11,17,20-21H,1-10,15H2,(H,18,19);2*1H/t11-,13+;;/m0../s1.
What are the key properties of (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride?
(2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride has a molecular weight of 375.10 g/mol, XLogP of 0.10, 9 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-6-borono-2-[2-[(3S)-3-hydroxypiperidin-1-yl]ethyl]hexanoic acid;dihydrochloride is sourced from PubChem (CID 66832804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).