C22H32N4O6S — CID 66833035
2-acetamido-N-tert-butyl-2-[(3R)-1-(2-nitrophenyl)sulfonylpyrrolidin-3-yl]hex-5-enamide (PubChem CID 66833035) has the molecular formula C22H32N4O6S and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-acetamido-N-tert-butyl-2-[(3R)-1-(2-nitrophenyl)sulfonylpyrrolidin-3-yl]hex-5-enamide.
| Compound Name | 2-acetamido-N-tert-butyl-2-[(3R)-1-(2-nitrophenyl)sulfonylpyrrolidin-3-yl]hex-5-enamide |
|---|---|
| PubChem CID | 66833035 |
| Molecular Formula | C22H32N4O6S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 2-acetamido-N-tert-butyl-2-[(3R)-1-(2-nitrophenyl)sulfonylpyrrolidin-3-yl]hex-5-enamide |
| SMILES | C=CCCC(NC(C)=O)(C(=O)NC(C)(C)C)[C@@H]1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C22H32N4O6S/c1-6-7-13-22(23-16(2)27,20(28)24-21(3,4)5)17-12-14-25(15-17)33(31,32)19-11-9-8-10-18(19)26(29)30/h6,8-11,17H,1,7,12-15H2,2-5H3,(H,23,27)(H,24,28)/t17-,22?/m1/s1 |
| InChIKey | HFBFAUNWXTUNAP-PLEWWHCXSA-N |
| XLogP | 2.36 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|