C14H28BNO4 — CID 66833580
ethyl 2-amino-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 66833580) has the molecular formula C14H28BNO4 and a molecular weight of 285.19 g/mol. Its IUPAC name is ethyl 2-amino-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | ethyl 2-amino-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 66833580 |
| Molecular Formula | C14H28BNO4 |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | ethyl 2-amino-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | CCOC(=O)C(N)CCCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H28BNO4/c1-6-18-12(17)11(16)9-7-8-10-15-19-13(2,3)14(4,5)20-15/h11H,6-10,16H2,1-5H3 |
| InChIKey | DXGIEAKTUXACIM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|