About 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile
8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile (PubChem CID 66833792) has the molecular formula C21H19N3O2
and a molecular weight of 345.40 g/mol. Its IUPAC name is 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile.
Molecular Properties
| Compound Name | 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile |
| PubChem CID | 66833792 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile |
| SMILES | CC1(C)c2cc(OCCN)ccc2C(=O)c2c1[nH]c1cc(C#N)ccc21 |
| InChI | InChI=1S/C21H19N3O2/c1-21(2)16-10-13(26-8-7-22)4-6-14(16)19(25)18-15-5-3-12(11-23)9-17(15)24-20(18)21/h3-6,9-10,24H,7-8,22H2,1-2H3 |
| InChIKey | UXBFRNQTNRAQNS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile?
The IUPAC name of 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile (CID 66833792) is 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile.
What is the SMILES notation for 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile?
The canonical SMILES for 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile is CC1(C)c2cc(OCCN)ccc2C(=O)c2c1[nH]c1cc(C#N)ccc21.
What is the InChIKey of 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile?
The InChIKey is UXBFRNQTNRAQNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O2/c1-21(2)16-10-13(26-8-7-22)4-6-14(16)19(25)18-15-5-3-12(11-23)9-17(15)24-20(18)21/h3-6,9-10,24H,7-8,22H2,1-2H3.
What are the key properties of 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile?
8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile has a molecular weight of 345.40 g/mol, XLogP of 3.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-aminoethoxy)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile is sourced from PubChem (CID 66833792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).