About 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile
8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile (PubChem CID 66834078) has the molecular formula C20H15BrN2O2
and a molecular weight of 395.26 g/mol. Its IUPAC name is 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile.
Molecular Properties
| Compound Name | 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile |
| PubChem CID | 66834078 |
| Molecular Formula | C20H15BrN2O2 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile |
| SMILES | COc1cc2c(cc1Br)C(C)(C)c1[nH]c3cc(C#N)ccc3c1C2=O |
| InChI | InChI=1S/C20H15BrN2O2/c1-20(2)13-8-14(21)16(25-3)7-12(13)18(24)17-11-5-4-10(9-22)6-15(11)23-19(17)20/h4-8,23H,1-3H3 |
| InChIKey | VHHHHRBBOLSTPE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile?
The IUPAC name of 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile (CID 66834078) is 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile.
What is the SMILES notation for 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile?
The canonical SMILES for 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile is COc1cc2c(cc1Br)C(C)(C)c1[nH]c3cc(C#N)ccc3c1C2=O.
What is the InChIKey of 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile?
The InChIKey is VHHHHRBBOLSTPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15BrN2O2/c1-20(2)13-8-14(21)16(25-3)7-12(13)18(24)17-11-5-4-10(9-22)6-15(11)23-19(17)20/h4-8,23H,1-3H3.
What are the key properties of 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile?
8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile has a molecular weight of 395.26 g/mol, XLogP of 4.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-9-methoxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile is sourced from PubChem (CID 66834078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).