About (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate
(3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate (PubChem CID 66834093) has the molecular formula C21H19N3O4S
and a molecular weight of 409.47 g/mol. Its IUPAC name is (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate.
Molecular Properties
| Compound Name | (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate |
| PubChem CID | 66834093 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate |
| SMILES | CN(C)S(=O)(=O)Oc1ccc2c(c1)C(C)(C)c1[nH]c3cc(C#N)ccc3c1C2=O |
| InChI | InChI=1S/C21H19N3O4S/c1-21(2)16-10-13(28-29(26,27)24(3)4)6-8-14(16)19(25)18-15-7-5-12(11-22)9-17(15)23-20(18)21/h5-10,23H,1-4H3 |
| InChIKey | OVPSKDFSXIRQCL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate?
The IUPAC name of (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate (CID 66834093) is (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate.
What is the SMILES notation for (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate?
The canonical SMILES for (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate is CN(C)S(=O)(=O)Oc1ccc2c(c1)C(C)(C)c1[nH]c3cc(C#N)ccc3c1C2=O.
What is the InChIKey of (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate?
The InChIKey is OVPSKDFSXIRQCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O4S/c1-21(2)16-10-13(28-29(26,27)24(3)4)6-8-14(16)19(25)18-15-7-5-12(11-22)9-17(15)23-20(18)21/h5-10,23H,1-4H3.
What are the key properties of (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate?
(3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate has a molecular weight of 409.47 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl) N,N-dimethylsulfamate is sourced from PubChem (CID 66834093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).