About 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile
11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile (PubChem CID 66834337) has the molecular formula C26H25N3O3
and a molecular weight of 427.50 g/mol. Its IUPAC name is 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile.
Molecular Properties
| Compound Name | 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile |
| PubChem CID | 66834337 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile |
| SMILES | N#Cc1ccc2c3c([nH]c2c1)C1(CCOCC1)c1cc(OC2CCNCC2)ccc1C3=O |
| InChI | InChI=1S/C26H25N3O3/c27-15-16-1-3-20-22(13-16)29-25-23(20)24(30)19-4-2-18(32-17-5-9-28-10-6-17)14-21(19)26(25)7-11-31-12-8-26/h1-4,13-14,17,28-29H,5-12H2 |
| InChIKey | LLKYHZAMNJXJDT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile?
The IUPAC name of 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile (CID 66834337) is 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile.
What is the SMILES notation for 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile?
The canonical SMILES for 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile is N#Cc1ccc2c3c([nH]c2c1)C1(CCOCC1)c1cc(OC2CCNCC2)ccc1C3=O.
What is the InChIKey of 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile?
The InChIKey is LLKYHZAMNJXJDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3O3/c27-15-16-1-3-20-22(13-16)29-25-23(20)24(30)19-4-2-18(32-17-5-9-28-10-6-17)14-21(19)26(25)7-11-31-12-8-26/h1-4,13-14,17,28-29H,5-12H2.
What are the key properties of 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile?
11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile has a molecular weight of 427.50 g/mol, XLogP of 3.81, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 11-oxo-8-piperidin-4-yloxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile is sourced from PubChem (CID 66834337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).