About 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane
2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane (PubChem CID 66834871) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane |
| PubChem CID | 66834871 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane |
| SMILES | Cc1ccc(OCC2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C13H18O3/c1-10-4-6-11(7-5-10)14-8-12-9-15-13(2,3)16-12/h4-7,12H,8-9H2,1-3H3 |
| InChIKey | DNHKWAFAFVWTQP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane?
The IUPAC name of 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane (CID 66834871) is 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane.
What is the SMILES notation for 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane?
The canonical SMILES for 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane is Cc1ccc(OCC2COC(C)(C)O2)cc1.
What is the InChIKey of 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane?
The InChIKey is DNHKWAFAFVWTQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-10-4-6-11(7-5-10)14-8-12-9-15-13(2,3)16-12/h4-7,12H,8-9H2,1-3H3.
What are the key properties of 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane?
2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane has a molecular weight of 222.28 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4-[(4-methylphenoxy)methyl]-1,3-dioxolane is sourced from PubChem (CID 66834871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).