About bis(2H-1,3-thiazol-3-yl)methanone
bis(2H-1,3-thiazol-3-yl)methanone (PubChem CID 66834987) has the molecular formula C7H8N2OS2
and a molecular weight of 200.29 g/mol. Its IUPAC name is bis(2H-1,3-thiazol-3-yl)methanone.
Molecular Properties
| Compound Name | bis(2H-1,3-thiazol-3-yl)methanone |
| PubChem CID | 66834987 |
| Molecular Formula | C7H8N2OS2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | bis(2H-1,3-thiazol-3-yl)methanone |
| SMILES | O=C(N1C=CSC1)N1C=CSC1 |
| InChI | InChI=1S/C7H8N2OS2/c10-7(8-1-3-11-5-8)9-2-4-12-6-9/h1-4H,5-6H2 |
| InChIKey | NHBFIFZGUQBIHG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(2H-1,3-thiazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2H-1,3-thiazol-3-yl)methanone?
The IUPAC name of bis(2H-1,3-thiazol-3-yl)methanone (CID 66834987) is bis(2H-1,3-thiazol-3-yl)methanone.
What is the SMILES notation for bis(2H-1,3-thiazol-3-yl)methanone?
The canonical SMILES for bis(2H-1,3-thiazol-3-yl)methanone is O=C(N1C=CSC1)N1C=CSC1.
What is the InChIKey of bis(2H-1,3-thiazol-3-yl)methanone?
The InChIKey is NHBFIFZGUQBIHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2OS2/c10-7(8-1-3-11-5-8)9-2-4-12-6-9/h1-4H,5-6H2.
What are the key properties of bis(2H-1,3-thiazol-3-yl)methanone?
bis(2H-1,3-thiazol-3-yl)methanone has a molecular weight of 200.29 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2H-1,3-thiazol-3-yl)methanone is sourced from PubChem (CID 66834987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).