C19H17Cl2NO — CID 66834992
2,3-dichloro-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazole (PubChem CID 66834992) has the molecular formula C19H17Cl2NO and a molecular weight of 346.26 g/mol. Its IUPAC name is 2,3-dichloro-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazole.
| Compound Name | 2,3-dichloro-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazole |
|---|---|
| PubChem CID | 66834992 |
| Molecular Formula | C19H17Cl2NO |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2,3-dichloro-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazole |
| SMILES | COc1ccc2c(c1)C(C)(C)c1[nH]c3cc(Cl)c(Cl)cc3c1C2 |
| InChI | InChI=1S/C19H17Cl2NO/c1-19(2)14-7-11(23-3)5-4-10(14)6-13-12-8-15(20)16(21)9-17(12)22-18(13)19/h4-5,7-9,22H,6H2,1-3H3 |
| InChIKey | DMXWTRLSVYJZEA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |