About [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol
[2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol (PubChem CID 66835293) has the molecular formula C17H11BrClF3N2O
and a molecular weight of 431.64 g/mol. Its IUPAC name is [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol.
Molecular Properties
| Compound Name | [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol |
| PubChem CID | 66835293 |
| Molecular Formula | C17H11BrClF3N2O |
| Molecular Weight | 431.64 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol |
| SMILES | Cc1nc(Br)n(-c2c(F)cccc2F)c1C(O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H11BrClF3N2O/c1-8-14(16(25)10-6-5-9(20)7-11(10)19)24(17(18)23-8)15-12(21)3-2-4-13(15)22/h2-7,16,25H,1H3 |
| InChIKey | GLGIDVVSWSCABT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol?
The IUPAC name of [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol (CID 66835293) is [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol.
What is the SMILES notation for [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol?
The canonical SMILES for [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol is Cc1nc(Br)n(-c2c(F)cccc2F)c1C(O)c1ccc(F)cc1Cl.
What is the InChIKey of [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol?
The InChIKey is GLGIDVVSWSCABT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11BrClF3N2O/c1-8-14(16(25)10-6-5-9(20)7-11(10)19)24(17(18)23-8)15-12(21)3-2-4-13(15)22/h2-7,16,25H,1H3.
What are the key properties of [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol?
[2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol has a molecular weight of 431.64 g/mol, XLogP of 5.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-bromo-3-(2,6-difluorophenyl)-5-methylimidazol-4-yl]-(2-chloro-4-fluorophenyl)methanol is sourced from PubChem (CID 66835293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).