About azane;2-methylprop-1-ene;pyrrolidine-2,5-dione
azane;2-methylprop-1-ene;pyrrolidine-2,5-dione (PubChem CID 66835333) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is azane;2-methylprop-1-ene;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | azane;2-methylprop-1-ene;pyrrolidine-2,5-dione |
| PubChem CID | 66835333 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | azane;2-methylprop-1-ene;pyrrolidine-2,5-dione |
| SMILES | C=C(C)C.N.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H5NO2.C4H8.H3N/c6-3-1-2-4(7)5-3;1-4(2)3;/h1-2H2,(H,5,6,7);1H2,2-3H3;1H3 |
| InChIKey | PNLCWSVLABFCJG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze azane;2-methylprop-1-ene;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methylprop-1-ene;pyrrolidine-2,5-dione?
The IUPAC name of azane;2-methylprop-1-ene;pyrrolidine-2,5-dione (CID 66835333) is azane;2-methylprop-1-ene;pyrrolidine-2,5-dione.
What is the SMILES notation for azane;2-methylprop-1-ene;pyrrolidine-2,5-dione?
The canonical SMILES for azane;2-methylprop-1-ene;pyrrolidine-2,5-dione is C=C(C)C.N.O=C1CCC(=O)N1.
What is the InChIKey of azane;2-methylprop-1-ene;pyrrolidine-2,5-dione?
The InChIKey is PNLCWSVLABFCJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C4H8.H3N/c6-3-1-2-4(7)5-3;1-4(2)3;/h1-2H2,(H,5,6,7);1H2,2-3H3;1H3.
What are the key properties of azane;2-methylprop-1-ene;pyrrolidine-2,5-dione?
azane;2-methylprop-1-ene;pyrrolidine-2,5-dione has a molecular weight of 172.23 g/mol, XLogP of 1.17, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methylprop-1-ene;pyrrolidine-2,5-dione is sourced from PubChem (CID 66835333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).