About 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile
3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile (PubChem CID 66835395) has the molecular formula C14H16N6S2
and a molecular weight of 332.46 g/mol. Its IUPAC name is 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile.
Molecular Properties
| Compound Name | 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile |
| PubChem CID | 66835395 |
| Molecular Formula | C14H16N6S2 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile |
| SMILES | N#Cc1nc(N2CCSCC2)c(C#N)nc1N1CCSCC1 |
| InChI | InChI=1S/C14H16N6S2/c15-9-11-13(19-1-5-21-6-2-19)17-12(10-16)14(18-11)20-3-7-22-8-4-20/h1-8H2 |
| InChIKey | YCRYUHQVSIXRCX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 79.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile?
The IUPAC name of 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile (CID 66835395) is 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile.
What is the SMILES notation for 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile?
The canonical SMILES for 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile is N#Cc1nc(N2CCSCC2)c(C#N)nc1N1CCSCC1.
What is the InChIKey of 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile?
The InChIKey is YCRYUHQVSIXRCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N6S2/c15-9-11-13(19-1-5-21-6-2-19)17-12(10-16)14(18-11)20-3-7-22-8-4-20/h1-8H2.
What are the key properties of 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile?
3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile has a molecular weight of 332.46 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dithiomorpholin-4-ylpyrazine-2,5-dicarbonitrile is sourced from PubChem (CID 66835395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).