About 13-fluoro-12-phenyl-21,22-dihydroporphyrin
13-fluoro-12-phenyl-21,22-dihydroporphyrin (PubChem CID 66835453) has the molecular formula C26H17FN4
and a molecular weight of 404.45 g/mol. Its IUPAC name is 13-fluoro-12-phenyl-21,22-dihydroporphyrin.
Molecular Properties
| Compound Name | 13-fluoro-12-phenyl-21,22-dihydroporphyrin |
| PubChem CID | 66835453 |
| Molecular Formula | C26H17FN4 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 13-fluoro-12-phenyl-21,22-dihydroporphyrin |
| SMILES | FC1=C(c2ccccc2)c2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3 |
| InChI | InChI=1S/C26H17FN4/c27-26-24-15-22-11-9-20(30-22)13-18-7-6-17(28-18)12-19-8-10-21(29-19)14-23(31-24)25(26)16-4-2-1-3-5-16/h1-15,28-29H/b17-12-,18-13-,19-12-,20-13-,21-14-,22-15-,23-14-,24-15- |
| InChIKey | PGCWOUHIILUGEV-WJXZCBKTSA-N |
| XLogP | 6.37 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 13-fluoro-12-phenyl-21,22-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-fluoro-12-phenyl-21,22-dihydroporphyrin?
The IUPAC name of 13-fluoro-12-phenyl-21,22-dihydroporphyrin (CID 66835453) is 13-fluoro-12-phenyl-21,22-dihydroporphyrin.
What is the SMILES notation for 13-fluoro-12-phenyl-21,22-dihydroporphyrin?
The canonical SMILES for 13-fluoro-12-phenyl-21,22-dihydroporphyrin is FC1=C(c2ccccc2)c2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.
What is the InChIKey of 13-fluoro-12-phenyl-21,22-dihydroporphyrin?
The InChIKey is PGCWOUHIILUGEV-WJXZCBKTSA-N. The full InChI is InChI=1S/C26H17FN4/c27-26-24-15-22-11-9-20(30-22)13-18-7-6-17(28-18)12-19-8-10-21(29-19)14-23(31-24)25(26)16-4-2-1-3-5-16/h1-15,28-29H/b17-12-,18-13-,19-12-,20-13-,21-14-,22-15-,23-14-,24-15-.
What are the key properties of 13-fluoro-12-phenyl-21,22-dihydroporphyrin?
13-fluoro-12-phenyl-21,22-dihydroporphyrin has a molecular weight of 404.45 g/mol, XLogP of 6.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 13-fluoro-12-phenyl-21,22-dihydroporphyrin is sourced from PubChem (CID 66835453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).