C21H37N3O3 — CID 66835709
2-acetamido-N-tert-butyl-2-[1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]hex-5-enamide (PubChem CID 66835709) has the molecular formula C21H37N3O3 and a molecular weight of 379.55 g/mol. Its IUPAC name is 2-acetamido-N-tert-butyl-2-[1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]hex-5-enamide.
| Compound Name | 2-acetamido-N-tert-butyl-2-[1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]hex-5-enamide |
|---|---|
| PubChem CID | 66835709 |
| Molecular Formula | C21H37N3O3 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | 2-acetamido-N-tert-butyl-2-[1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]hex-5-enamide |
| SMILES | C=CCCC(NC(C)=O)(C(=O)NC(C)(C)C)C1CCN(C(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H37N3O3/c1-9-10-12-21(22-15(2)25,17(26)23-20(6,7)8)16-11-13-24(14-16)18(27)19(3,4)5/h9,16H,1,10-14H2,2-8H3,(H,22,25)(H,23,26) |
| InChIKey | IFBOQHKHVLJLHO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|