About 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine
1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine (PubChem CID 66836617) has the molecular formula C11H12BrF2N
and a molecular weight of 276.12 g/mol. Its IUPAC name is 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine |
| PubChem CID | 66836617 |
| Molecular Formula | C11H12BrF2N |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine |
| SMILES | Fc1cc(Br)c(CN2CCCC2)cc1F |
| InChI | InChI=1S/C11H12BrF2N/c12-9-6-11(14)10(13)5-8(9)7-15-3-1-2-4-15/h5-6H,1-4,7H2 |
| InChIKey | DFSVWWOMGNVAMT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine?
The IUPAC name of 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine (CID 66836617) is 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine.
What is the SMILES notation for 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine?
The canonical SMILES for 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine is Fc1cc(Br)c(CN2CCCC2)cc1F.
What is the InChIKey of 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine?
The InChIKey is DFSVWWOMGNVAMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrF2N/c12-9-6-11(14)10(13)5-8(9)7-15-3-1-2-4-15/h5-6H,1-4,7H2.
What are the key properties of 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine?
1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine has a molecular weight of 276.12 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-bromo-4,5-difluorophenyl)methyl]pyrrolidine is sourced from PubChem (CID 66836617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).