About [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol
[(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol (PubChem CID 66836942) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol.
Molecular Properties
| Compound Name | [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol |
| PubChem CID | 66836942 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol |
| SMILES | OC[C@@H]1C[C@H]1c1ccc2ncccc2n1 |
| InChI | InChI=1S/C12H12N2O/c15-7-8-6-9(8)10-3-4-11-12(14-10)2-1-5-13-11/h1-5,8-9,15H,6-7H2/t8-,9+/m0/s1 |
| InChIKey | UIYXGIUTGHATCV-DTWKUNHWSA-N |
| XLogP | 1.73 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol?
The IUPAC name of [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol (CID 66836942) is [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol.
What is the SMILES notation for [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol?
The canonical SMILES for [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol is OC[C@@H]1C[C@H]1c1ccc2ncccc2n1.
What is the InChIKey of [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol?
The InChIKey is UIYXGIUTGHATCV-DTWKUNHWSA-N. The full InChI is InChI=1S/C12H12N2O/c15-7-8-6-9(8)10-3-4-11-12(14-10)2-1-5-13-11/h1-5,8-9,15H,6-7H2/t8-,9+/m0/s1.
What are the key properties of [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol?
[(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol has a molecular weight of 200.24 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-(1,5-naphthyridin-2-yl)cyclopropyl]methanol is sourced from PubChem (CID 66836942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).